1-(3-methoxy-4-(prop-2-yn-1-yloxy)phenyl)ethan-1-one is a versatile chemical building block widely used in organic synthesis, providing essential structural components for pharmaceutical, agrochemical, and material science research. It serves as a key intermediate in the development of complex molecules, enabling the synthesis of bioactive compounds, functional materials, and innovative drug candidates. Researchers and students in organic chemistry and pharmaceutical sciences rely on 1-(3-methoxy-4-(prop-2-yn-1-yloxy)phenyl)ethan-1-one for its stability, reactivity, and compatibility with various synthetic methodologies, making it an indispensable tool in modern chemical research.
| CAS Number | 956597-80-1 |
| Molecular Formula | C12H12O3 |
| Purity | 97% |
| Storage | 2-8°C |
| IUPAC Name | 1-(3-methoxy-4-prop-2-ynoxyphenyl)ethanone |
| InChI | InChI=1S/C12H12O3/c1-4-7-15-11-6-5-10(9(2)13)8-12(11)14-3/h1,5-6,8H,7H2,2-3H3 |
| SMILES | CC(=O)C1=CC(=C(C=C1)OCC#C)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |




Reviews
There are no reviews yet.